CAS 2408654-22-6 is the registry number for Pyrazolo[1,5-a]pyridin-6-ylboronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Pyrazolo[1,5-a]pyridin-6-ylboronic acid (CAS 2408654-22-6) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: pyrazolo[1,5-a]pyridin-6-ylboronic acid. InChIKey: QEHBKTCEMAWMTO-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyridin-6-ylboronic acid |
| InChIKey | QEHBKTCEMAWMTO-UHFFFAOYSA-N |
| SMILES | B(C1=CN2C(=CC=N2)C=C1)(O)O |
Computed by PubChem (NCBI)