Products 24095-51-0
CAS 24095-51-0 is the registry number for N-(4-(Aminomethyl)phenyl)-N-methylacetamide hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
N-[4-(aminomethyl)phenyl]-N-methylacetamide;hydrochloride (CAS 24095-51-0) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: N-[4-(aminomethyl)phenyl]-N-methylacetamide;hydrochloride. InChIKey: DCRAJDBMDPNDAH-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | N-[4-(aminomethyl)phenyl]-N-methylacetamide;hydrochloride |
| InChIKey | DCRAJDBMDPNDAH-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)