CAS 2410249-78-2 is the registry number for 5-Bromo-4,7-dimethoxy-1H-indole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4,7-dimethoxy-1H-indole (CAS 2410249-78-2) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 5-bromo-4,7-dimethoxy-1H-indole. InChIKey: CVMGYJWPCSOZTG-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 5-bromo-4,7-dimethoxy-1H-indole |
| InChIKey | CVMGYJWPCSOZTG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=C1NC=C2)OC)Br |
Computed by PubChem (NCBI)