Products 2411250-19-4
CAS 2411250-19-4 is the registry number for 2-Chloro-3-fluoro-5-[(oxiran-2-yl)methoxy]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-3-fluoro-5-(oxiran-2-ylmethoxy)pyridine (CAS 2411250-19-4) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: 2-chloro-3-fluoro-5-(oxiran-2-ylmethoxy)pyridine. InChIKey: UKOMQRQFDIJTRM-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | 2-chloro-3-fluoro-5-(oxiran-2-ylmethoxy)pyridine |
| InChIKey | UKOMQRQFDIJTRM-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC(=C(N=C2)Cl)F |
Computed by PubChem (NCBI)