Products 2411636-48-9
CAS 2411636-48-9 appears in our catalog under these names: 1-(3-(Trifluoromethyl)pyridin-2-yl)ethan-1-amine (hydrochloride), 95%, 95%, 1-(3-(Trifluoromethyl)pyridin-2-yl)ethan-1-amine (hydrochloride), 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
1-[3-(trifluoromethyl)-2-pyridinyl]ethanamine;hydrochloride (CAS 2411636-48-9) is a chemical compound with the molecular formula C8H10ClF3N2 and a molecular weight of 226.62 g/mol. IUPAC name: 1-[3-(trifluoromethyl)-2-pyridinyl]ethanamine;hydrochloride. InChIKey: PPLFLAJMJDBWLB-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF3N2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)-2-pyridinyl]ethanamine;hydrochloride |
| InChIKey | PPLFLAJMJDBWLB-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC=N1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)