CAS 2411639-80-8 appears in our catalog under these names: 3,3–Dimethylindolin–4–amine dihydrochloride, 3,3-Dimethylindolin-4-amine dihydrochloride 97%, 3,3-Dimethylindolin-4-amine dihydrochloride, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3,3-dimethyl-1,2-dihydroindol-4-amine;dihydrochloride (CAS 2411639-80-8) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 3,3-dimethyl-1,2-dihydroindol-4-amine;dihydrochloride. InChIKey: ZSTQBGVMWPVHAN-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 3,3-dimethyl-1,2-dihydroindol-4-amine;dihydrochloride |
| InChIKey | ZSTQBGVMWPVHAN-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=CC=CC(=C21)N)C.Cl.Cl |
Computed by PubChem (NCBI)