Products 2413782-12-2
CAS 2413782-12-2 appears in our catalog under these names: (S)-Cyclopropyl(4-methylpyridin-2-yl)methanamine hydrochloride, 98%, (S)-Cyclopropyl(4-methylpyridin-2-yl)methanamine hydrochloride, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
(S)-cyclopropyl-(4-methyl-2-pyridinyl)methanamine;hydrochloride (CAS 2413782-12-2) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: (S)-cyclopropyl-(4-methyl-2-pyridinyl)methanamine;hydrochloride. InChIKey: NGMUZXJMEJSREQ-PPHPATTJSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | (S)-cyclopropyl-(4-methyl-2-pyridinyl)methanamine;hydrochloride |
| InChIKey | NGMUZXJMEJSREQ-PPHPATTJSA-N |
| SMILES | CC1=CC(=NC=C1)[C@H](C2CC2)N.Cl |
Computed by PubChem (NCBI)