Products 26631-90-3
CAS 26631-90-3 appears in our catalog under these names: Sulbactam EP Impurity D, Brobactam. Offered by: Chemat Brand, TargetMol, Biosynth, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg, Get quote.
(2S,5R,6R)-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 26631-90-3) is a chemical compound with the molecular formula C8H10BrNO3S and a molecular weight of 280.14 g/mol. IUPAC name: (2S,5R,6R)-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: DAVPSCAAXXVSFU-ALEPSDHESA-N.
| Molecular formula | C8H10BrNO3S |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | (2S,5R,6R)-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | DAVPSCAAXXVSFU-ALEPSDHESA-N |
| SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)Br)C(=O)O)C |
Computed by PubChem (NCBI)