Products 24144-61-4
CAS 24144-61-4 is the registry number for (+)-cis-Khellactone, 98.00%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
(9R,10R)-9,10-dihydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one (CAS 24144-61-4) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: (9R,10R)-9,10-dihydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one. InChIKey: HKXQUNNSKMWIKJ-DGCLKSJQSA-N.
| Molecular formula | C14H14O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | (9R,10R)-9,10-dihydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
| InChIKey | HKXQUNNSKMWIKJ-DGCLKSJQSA-N |
| SMILES | CC1([C@@H]([C@@H](C2=C(O1)C=CC3=C2OC(=O)C=C3)O)O)C |
Computed by PubChem (NCBI)