Products 314742-23-9

CAS 314742-23-9 is the registry number for 2-[(4-Ethyl-2-oxo-2h-chromen-7-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-ethyl-2-oxochromen-7-yl)oxypropanoic acid (CAS 314742-23-9) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 2-(4-ethyl-2-oxochromen-7-yl)oxypropanoic acid. InChIKey: VBUUPJHPJVEUIA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O5
Molecular weight262.26 g/mol
IUPAC name2-(4-ethyl-2-oxochromen-7-yl)oxypropanoic acid
InChIKeyVBUUPJHPJVEUIA-UHFFFAOYSA-N
SMILESCCC1=CC(=O)OC2=C1C=CC(=C2)OC(C)C(=O)O

Computed by PubChem (NCBI)