CAS 15795-56-9 appears in our catalog under these names: 5-(2-Methoxybenzylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95%, 5-((2-methoxyphenyl)methylene)-2,2-dimethyl-1,3-dioxane-4,6-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg.
5-[(2-methoxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 15795-56-9) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 5-[(2-methoxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: CNEJJACJHKSHJO-UHFFFAOYSA-N.
| Molecular formula | C14H14O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 5-[(2-methoxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | CNEJJACJHKSHJO-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CC2=CC=CC=C2OC)C(=O)O1)C |
Computed by PubChem (NCBI)