Products 843638-34-6

CAS 843638-34-6 is the registry number for 2-[(4,7-Dimethyl-2-oxo-2h-chromen-5-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoic acid (CAS 843638-34-6) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoic acid. InChIKey: RRBYJHZOUKCMHA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O5
Molecular weight262.26 g/mol
IUPAC name2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoic acid
InChIKeyRRBYJHZOUKCMHA-UHFFFAOYSA-N
SMILESCC1=CC2=C(C(=CC(=O)O2)C)C(=C1)OC(C)C(=O)O

Computed by PubChem (NCBI)