CAS 843638-34-6 is the registry number for 2-[(4,7-Dimethyl-2-oxo-2h-chromen-5-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoic acid (CAS 843638-34-6) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoic acid. InChIKey: RRBYJHZOUKCMHA-UHFFFAOYSA-N.
| Molecular formula | C14H14O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 2-(4,7-dimethyl-2-oxochromen-5-yl)oxypropanoic acid |
| InChIKey | RRBYJHZOUKCMHA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=CC(=O)O2)C)C(=C1)OC(C)C(=O)O |
Computed by PubChem (NCBI)