Products 858744-13-5
CAS 858744-13-5 is the registry number for 3-(7-Methoxy-4-methyl-2-oxo-2h-chromen-3-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoic acid (CAS 858744-13-5) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoic acid. InChIKey: RIWPTYLEWDIAJI-UHFFFAOYSA-N.
| Molecular formula | C14H14O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoic acid |
| InChIKey | RIWPTYLEWDIAJI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)OC)CCC(=O)O |
Computed by PubChem (NCBI)