Products 2417134-05-3
CAS 2417134-05-3 is the registry number for Tubulin polymerization-IN-14. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[1-[2-chloro-6-(methylamino)-4-pyridinyl]ethenyl]-2-methoxyphenol (CAS 2417134-05-3) is a chemical compound with the molecular formula C15H15ClN2O2 and a molecular weight of 290.74 g/mol. IUPAC name: 5-[1-[2-chloro-6-(methylamino)-4-pyridinyl]ethenyl]-2-methoxyphenol. InChIKey: UFIULXZVOMUUBC-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O2 |
|---|---|
| Molecular weight | 290.74 g/mol |
| IUPAC name | 5-[1-[2-chloro-6-(methylamino)-4-pyridinyl]ethenyl]-2-methoxyphenol |
| InChIKey | UFIULXZVOMUUBC-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=CC(=C1)C(=C)C2=CC(=C(C=C2)OC)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
Tubulin polymerization-IN-14, orb1689426