Products 2417387-48-3
CAS 2417387-48-3 is the registry number for 7-Bromo-1,3-dihydroisobenzofuran-4-carbaldehyde, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
7-bromo-1,3-dihydro-2-benzofuran-4-carbaldehyde (CAS 2417387-48-3) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 7-bromo-1,3-dihydro-2-benzofuran-4-carbaldehyde. InChIKey: ODIBGDLEXHFRCR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 7-bromo-1,3-dihydro-2-benzofuran-4-carbaldehyde |
| InChIKey | ODIBGDLEXHFRCR-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2CO1)Br)C=O |
Computed by PubChem (NCBI)