Products 24176-83-8
CAS 24176-83-8 is the registry number for Phenacetin Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorophenyl)imino-(4-ethoxyphenyl)-oxidoazanium (CAS 24176-83-8) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: (4-chlorophenyl)imino-(4-ethoxyphenyl)-oxidoazanium. InChIKey: PEKGUWQHPITBRB-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2 |
|---|---|
| Molecular weight | 276.72 g/mol |
| IUPAC name | (4-chlorophenyl)imino-(4-ethoxyphenyl)-oxidoazanium |
| InChIKey | PEKGUWQHPITBRB-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)[N+](=NC2=CC=C(C=C2)Cl)[O-] |
Computed by PubChem (NCBI)