CAS 2417969-85-6 is the registry number for Methyl 6-bromo-1,2,2a,7b-tetrahydro-3H-cyclobuta[b]indole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-bromo-1,2,2a,7b-tetrahydrocyclobuta[b]indole-3-carboxylate (CAS 2417969-85-6) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: methyl 6-bromo-1,2,2a,7b-tetrahydrocyclobuta[b]indole-3-carboxylate. InChIKey: RDFDRVXQRJAVDD-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | methyl 6-bromo-1,2,2a,7b-tetrahydrocyclobuta[b]indole-3-carboxylate |
| InChIKey | RDFDRVXQRJAVDD-UHFFFAOYSA-N |
| SMILES | COC(=O)N1C2CCC2C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)