CAS 241800-37-3 appears in our catalog under these names: 5–Cyclopropyl–1–(2–methylphenyl)–1H–pyrazole–4–carboxylic acid, 5-Cyclopropyl-1-(2-methylphenyl)-1H-pyrazole-4-carboxylic acid, 95%, 95%, 5-Cyclopropyl-1-(2-methylphenyl)-1H-pyrazole-4-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-cyclopropyl-1-(2-methylphenyl)pyrazole-4-carboxylic acid (CAS 241800-37-3) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: 5-cyclopropyl-1-(2-methylphenyl)pyrazole-4-carboxylic acid. InChIKey: CLTLGJDAUAROIU-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 5-cyclopropyl-1-(2-methylphenyl)pyrazole-4-carboxylic acid |
| InChIKey | CLTLGJDAUAROIU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=C(C=N2)C(=O)O)C3CC3 |
Computed by PubChem (NCBI)