Products 2418014-98-7
CAS 2418014-98-7 appears in our catalog under these names: ART-IN-1, 98%, ART-IN-1, 98.91%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 5 mg, 10 mg, 25 mg, 50 mg.
8-propan-2-yloxy-4H-thieno[2,3-c]isoquinolin-5-one (CAS 2418014-98-7) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: 8-propan-2-yloxy-4H-thieno[2,3-c]isoquinolin-5-one. InChIKey: RRNITWOICYYQGQ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 8-propan-2-yloxy-4H-thieno[2,3-c]isoquinolin-5-one |
| InChIKey | RRNITWOICYYQGQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C1)C(=O)NC3=C2C=CS3 |
Computed by PubChem (NCBI)