CAS 2420-17-9 appears in our catalog under these names: 5–(4–Hydroxyphenyl)hydantoin, 5-(4-Hydroxyphenyl)hydantoin, >98.0%(N)(HPLC), 5-(4-Hydroxyphenyl)imidazolidine-2,4-dione, 98%, 5-(4-Hydroxyphenyl)imidazolidine-2,4-dione 98%. Offered by: GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 500g, 1g, 1kg, 1000g.
5-(4-hydroxyphenyl)imidazolidine-2,4-dione (CAS 2420-17-9) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 5-(4-hydroxyphenyl)imidazolidine-2,4-dione. InChIKey: UMTNMIARZPDSDI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)imidazolidine-2,4-dione |
| InChIKey | UMTNMIARZPDSDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2C(=O)NC(=O)N2)O |
Computed by PubChem (NCBI)