Products 2421133-53-9

CAS 2421133-53-9 is the registry number for Ethyl 2-nitro-1H-imidazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

Ethyl 2-nitro-1H-imidazole-5-carboxylate (CAS 2421133-53-9) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: ethyl 2-nitro-1H-imidazole-5-carboxylate. InChIKey: JMSJAPVDMIPABT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7N3O4
Molecular weight185.14 g/mol
IUPAC nameethyl 2-nitro-1H-imidazole-5-carboxylate
InChIKeyJMSJAPVDMIPABT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C(N1)[N+](=O)[O-]

Computed by PubChem (NCBI)