CAS 2421133-53-9 is the registry number for Ethyl 2-nitro-1H-imidazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg.
Ethyl 2-nitro-1H-imidazole-5-carboxylate (CAS 2421133-53-9) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: ethyl 2-nitro-1H-imidazole-5-carboxylate. InChIKey: JMSJAPVDMIPABT-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | ethyl 2-nitro-1H-imidazole-5-carboxylate |
| InChIKey | JMSJAPVDMIPABT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)