CAS 24242-17-9 appears in our catalog under these names: 5-Carbamoylpyridine-3-carboxylic acid, 98%, 5-Carbamoylnicotinic acid, 98%, 5-Carbamoylpyridine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 10g, 25g, 5g, 100mg.
5-carbamoylpyridine-3-carboxylic acid (CAS 24242-17-9) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 5-carbamoylpyridine-3-carboxylic acid. InChIKey: SRIRTFSQYOUBGL-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 5-carbamoylpyridine-3-carboxylic acid |
| InChIKey | SRIRTFSQYOUBGL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1C(=O)O)C(=O)N |
Computed by PubChem (NCBI)