CAS 24242-18-0 is the registry number for 5-Carbamoylpyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-carbamoylpyridine-2-carboxylic acid (CAS 24242-18-0) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 5-carbamoylpyridine-2-carboxylic acid. InChIKey: KGBSMDOELQXOBN-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 5-carbamoylpyridine-2-carboxylic acid |
| InChIKey | KGBSMDOELQXOBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)N)C(=O)O |
Computed by PubChem (NCBI)