Products 24242-18-0

CAS 24242-18-0 is the registry number for 5-Carbamoylpyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

5-carbamoylpyridine-2-carboxylic acid (CAS 24242-18-0) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 5-carbamoylpyridine-2-carboxylic acid. InChIKey: KGBSMDOELQXOBN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O3
Molecular weight166.13 g/mol
IUPAC name5-carbamoylpyridine-2-carboxylic acid
InChIKeyKGBSMDOELQXOBN-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1C(=O)N)C(=O)O

Computed by PubChem (NCBI)