CAS 242461-73-0 is the registry number for 4-Amino-2-nitrobenzamide, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-amino-2-nitrobenzamide (CAS 242461-73-0) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 4-amino-2-nitrobenzamide. InChIKey: RIPSCKWBMLFTEB-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-amino-2-nitrobenzamide |
| InChIKey | RIPSCKWBMLFTEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)