Products 2426-82-6
CAS 2426-82-6 is the registry number for 3-(2-Aminoethyl)-5-methoxy-1H-indol-6-ol. Offered by: Biosynth. Available pack sizes: 1g.
3-(2-aminoethyl)-5-methoxy-1H-indol-6-ol (CAS 2426-82-6) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 3-(2-aminoethyl)-5-methoxy-1H-indol-6-ol. InChIKey: KNQXRUNVHVEFFD-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 3-(2-aminoethyl)-5-methoxy-1H-indol-6-ol |
| InChIKey | KNQXRUNVHVEFFD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CN2)CCN)O |
Computed by PubChem (NCBI)