CAS 2427000-22-2 is the registry number for 1,1-Dioxide 4-(3-Methoxy-4-nitrophenyl)-thiomorpholine. Offered by: TRC. Available pack sizes: 2,5g.
4-(3-methoxy-4-nitrophenyl)-1,4-thiazinane 1,1-dioxide (CAS 2427000-22-2) is a chemical compound with the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. IUPAC name: 4-(3-methoxy-4-nitrophenyl)-1,4-thiazinane 1,1-dioxide. InChIKey: HXMPDZBWGPYBLX-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5S |
|---|---|
| Molecular weight | 286.31 g/mol |
| IUPAC name | 4-(3-methoxy-4-nitrophenyl)-1,4-thiazinane 1,1-dioxide |
| InChIKey | HXMPDZBWGPYBLX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCS(=O)(=O)CC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)