CAS 24359-81-7 appears in our catalog under these names: Antazoline Sulfate, Antazolin Sulfate. Offered by: Creative Peptides, Chemat Brand. Available pack sizes: on request.
N-benzyl-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline;sulfuric acid (CAS 24359-81-7) is a chemical compound with the molecular formula C17H21N3O4S and a molecular weight of 363.4 g/mol. IUPAC name: N-benzyl-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline;sulfuric acid. InChIKey: UWOSJBSLQYMGDL-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O4S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | N-benzyl-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline;sulfuric acid |
| InChIKey | UWOSJBSLQYMGDL-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)CN(CC2=CC=CC=C2)C3=CC=CC=C3.OS(=O)(=O)O |
Computed by PubChem (NCBI)