CAS 685506-42-7 appears in our catalog under these names: GSK 264220A, GSK 264220A, GSK264220A, GSK264220A 99%, GSK264220A, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 2mg, 25mg, 50mg, 100mg, 1mg, 10mg, 5mg.
1-(2-methyl-5-piperidin-1-ylsulfonylfuran-3-yl)-3-phenylurea (CAS 685506-42-7) is a chemical compound with the molecular formula C17H21N3O4S and a molecular weight of 363.4 g/mol. IUPAC name: 1-(2-methyl-5-piperidin-1-ylsulfonylfuran-3-yl)-3-phenylurea. InChIKey: LVOVQRPAMXCXTM-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O4S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 1-(2-methyl-5-piperidin-1-ylsulfonylfuran-3-yl)-3-phenylurea |
| InChIKey | LVOVQRPAMXCXTM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)S(=O)(=O)N2CCCCC2)NC(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)