CAS 328028-55-3 is the registry number for 3-Amino-n-(4-methoxy-phenyl)-4-morpholin-4-yl-benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-amino-N-(4-methoxyphenyl)-4-morpholin-4-ylbenzenesulfonamide (CAS 328028-55-3) is a chemical compound with the molecular formula C17H21N3O4S and a molecular weight of 363.4 g/mol. IUPAC name: 3-amino-N-(4-methoxyphenyl)-4-morpholin-4-ylbenzenesulfonamide. InChIKey: CJCRCJOYANWZJE-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O4S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 3-amino-N-(4-methoxyphenyl)-4-morpholin-4-ylbenzenesulfonamide |
| InChIKey | CJCRCJOYANWZJE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)N3CCOCC3)N |
Computed by PubChem (NCBI)