CAS 497060-94-3 is the registry number for 1-((2,5-dimethoxyphenyl)sulfonyl)-4-(2-pyridyl)piperazine. Offered by: Biosynth. Available pack sizes: 250mg.
1-(2,5-dimethoxyphenyl)sulfonyl-4-pyridin-2-ylpiperazine (CAS 497060-94-3) is a chemical compound with the molecular formula C17H21N3O4S and a molecular weight of 363.4 g/mol. IUPAC name: 1-(2,5-dimethoxyphenyl)sulfonyl-4-pyridin-2-ylpiperazine. InChIKey: XEHDUBMVXJTPNC-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O4S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 1-(2,5-dimethoxyphenyl)sulfonyl-4-pyridin-2-ylpiperazine |
| InChIKey | XEHDUBMVXJTPNC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)S(=O)(=O)N2CCN(CC2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)