Products 60189-52-8
CAS 60189-52-8 is the registry number for For-Met-Trp-OH. Offered by: Creative Peptides. Available pack sizes: on request.
(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (CAS 60189-52-8) is a chemical compound with the molecular formula C17H21N3O4S and a molecular weight of 363.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: AAIWVNZNCMTTQF-GJZGRUSLSA-N.
| Molecular formula | C17H21N3O4S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | AAIWVNZNCMTTQF-GJZGRUSLSA-N |
| SMILES | CSCC[C@@H](C(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)O)NC=O |
Computed by PubChem (NCBI)