CAS 2437-11-8 is the registry number for Phenacetin Impurity 21. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-phenyldiazenylphenol (CAS 2437-11-8) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 3-phenyldiazenylphenol. InChIKey: JJDKCHBQWVTFBN-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-phenyldiazenylphenol |
| InChIKey | JJDKCHBQWVTFBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)