Products 243835-94-1

CAS 243835-94-1 is the registry number for 1,3-Dimethyl 2-(4-bromophenyl)-2-methylpropanedioate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Dimethyl 2-(4-bromophenyl)-2-methylpropanedioate (CAS 243835-94-1) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: dimethyl 2-(4-bromophenyl)-2-methylpropanedioate. InChIKey: GTYUMTWAFLMFRB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13BrO4
Molecular weight301.13 g/mol
IUPAC namedimethyl 2-(4-bromophenyl)-2-methylpropanedioate
InChIKeyGTYUMTWAFLMFRB-UHFFFAOYSA-N
SMILESCC(C1=CC=C(C=C1)Br)(C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)