CAS 243835-94-1 is the registry number for 1,3-Dimethyl 2-(4-bromophenyl)-2-methylpropanedioate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Dimethyl 2-(4-bromophenyl)-2-methylpropanedioate (CAS 243835-94-1) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: dimethyl 2-(4-bromophenyl)-2-methylpropanedioate. InChIKey: GTYUMTWAFLMFRB-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO4 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | dimethyl 2-(4-bromophenyl)-2-methylpropanedioate |
| InChIKey | GTYUMTWAFLMFRB-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)(C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)