CAS 24393-66-6 appears in our catalog under these names: Ethyl 3-(2h-1,3-benzodioxol-5-yl)prop-2-enoate, 95%, Ethyl (2E)-3-(1,3-dioxaindan-5-yl)prop-2-enoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
Ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (CAS 24393-66-6) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate. InChIKey: PTMOFMXIIKUMTA-GQCTYLIASA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| InChIKey | PTMOFMXIIKUMTA-GQCTYLIASA-N |
| SMILES | CCOC(=O)/C=C/C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)