CAS 24393-79-1 is the registry number for Cacalol. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-3,4,5-trimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-ol (CAS 24393-79-1) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: (5S)-3,4,5-trimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-ol. InChIKey: OUFUBABGIIEJNV-QMMMGPOBSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (5S)-3,4,5-trimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-ol |
| InChIKey | OUFUBABGIIEJNV-QMMMGPOBSA-N |
| SMILES | C[C@H]1CCCC2=C1C(=C3C(=COC3=C2O)C)C |
Computed by PubChem (NCBI)