CAS 244127-42-2 is the registry number for 7-Chloro-3,5-dimethylpyrazolo(1,5-a)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-chloro-3,5-dimethylpyrazolo[1,5-a]pyrimidine (CAS 244127-42-2) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 7-chloro-3,5-dimethylpyrazolo[1,5-a]pyrimidine. InChIKey: CZEKNLREIQNGCT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 7-chloro-3,5-dimethylpyrazolo[1,5-a]pyrimidine |
| InChIKey | CZEKNLREIQNGCT-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NN2C(=C1)Cl)C |
Computed by PubChem (NCBI)