Products 244204-40-8
CAS 244204-40-8 is the registry number for Celaphanol A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 1 mg, 5 mg, 10 mg.
(4aR)-6,7,10-trihydroxy-1,1,4a-trimethyl-3,4-dihydro-2H-phenanthren-9-one (CAS 244204-40-8) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: (4aR)-6,7,10-trihydroxy-1,1,4a-trimethyl-3,4-dihydro-2H-phenanthren-9-one. InChIKey: MLGLJFWISHCOAE-QGZVFWFLSA-N.
| Molecular formula | C17H20O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (4aR)-6,7,10-trihydroxy-1,1,4a-trimethyl-3,4-dihydro-2H-phenanthren-9-one |
| InChIKey | MLGLJFWISHCOAE-QGZVFWFLSA-N |
| SMILES | C[C@]12CCCC(C1=C(C(=O)C3=CC(=C(C=C23)O)O)O)(C)C |
Computed by PubChem (NCBI)