CAS 2444-21-5 is the registry number for 4-(Benzyloxy)phenyl benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-phenylmethoxyphenyl) benzoate (CAS 2444-21-5) is a chemical compound with the molecular formula C20H16O3 and a molecular weight of 304.3 g/mol. IUPAC name: (4-phenylmethoxyphenyl) benzoate. InChIKey: HUGHGOGHBVKYGN-UHFFFAOYSA-N.
| Molecular formula | C20H16O3 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | (4-phenylmethoxyphenyl) benzoate |
| InChIKey | HUGHGOGHBVKYGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)