Products 2446366-95-4
CAS 2446366-95-4 appears in our catalog under these names: Pyriproxyfen-D4, >95% (HPLC), (±)-Pyriproxyfen-d4 (pyridyl-d4), 99 atom % D, min 98% Chemical Purity, Pyriproxyfen-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 1 mg, 10 mg.
2,3,4,5-tetradeuterio-6-[1-(4-phenoxyphenoxy)propan-2-yloxy]pyridine (CAS 2446366-95-4) is a chemical compound with the molecular formula C20H19NO3 and a molecular weight of 325.4 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-[1-(4-phenoxyphenoxy)propan-2-yloxy]pyridine. InChIKey: NHDHVHZZCFYRSB-GEAZLQEVSA-N.
| Molecular formula | C20H19NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-[1-(4-phenoxyphenoxy)propan-2-yloxy]pyridine |
| InChIKey | NHDHVHZZCFYRSB-GEAZLQEVSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])OC(C)COC2=CC=C(C=C2)OC3=CC=CC=C3)[2H])[2H] |
Computed by PubChem (NCBI)