CAS 2673269-99-1 is the registry number for Pyriproxyfen-d6. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-[1,1,1,2,3,3-hexadeuterio-3-(4-phenoxyphenoxy)propan-2-yl]oxypyridine (CAS 2673269-99-1) is a chemical compound with the molecular formula C20H19NO3 and a molecular weight of 327.4 g/mol. IUPAC name: 2-[1,1,1,2,3,3-hexadeuterio-3-(4-phenoxyphenoxy)propan-2-yl]oxypyridine. InChIKey: NHDHVHZZCFYRSB-LGSOXFGXSA-N.
| Molecular formula | C20H19NO3 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 2-[1,1,1,2,3,3-hexadeuterio-3-(4-phenoxyphenoxy)propan-2-yl]oxypyridine |
| InChIKey | NHDHVHZZCFYRSB-LGSOXFGXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])OC1=CC=C(C=C1)OC2=CC=CC=C2)OC3=CC=CC=N3 |
Computed by PubChem (NCBI)