Products 24467-92-3

CAS 24467-92-3 is the registry number for 5-Methoxy-1-indanone-3-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(6-methoxy-3-oxo-1,2-dihydroinden-1-yl)acetic acid (CAS 24467-92-3) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 2-(6-methoxy-3-oxo-1,2-dihydroinden-1-yl)acetic acid. InChIKey: QOTZOFGBBCMWEP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O4
Molecular weight220.22 g/mol
IUPAC name2-(6-methoxy-3-oxo-1,2-dihydroinden-1-yl)acetic acid
InChIKeyQOTZOFGBBCMWEP-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C(=O)CC2CC(=O)O

Computed by PubChem (NCBI)