Products 245-08-9
CAS 245-08-9 appears in our catalog under these names: delta-Carboline, 5H-Pyrido[3,2-b]indole, >98.0%(HPLC), 5H-Pyrido[3,2-b]indole 95%, 5H-PYRIDO[3,2-B]INDOLE, δ-Carboline, 99.92%. Offered by: TRC, TCI, Ambeed, Sigma-Aldrich, MedChemExpress. Available pack sizes: 500mg, 100mg, 10g, 250mg, 1g, 5g, 500 mg, 5 g.
5H-pyrido[3,2-b]indole (CAS 245-08-9) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 5H-pyrido[3,2-b]indole. InChIKey: NSBVOLBUJPCPFH-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 5H-pyrido[3,2-b]indole |
| InChIKey | NSBVOLBUJPCPFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC=N3 |
Computed by PubChem (NCBI)