CAS 24506-68-1 is the registry number for Barakol. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,7,9(13),10-pentaene-5,11-diol (CAS 24506-68-1) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,7,9(13),10-pentaene-5,11-diol. InChIKey: LVPNMZHEDIKUFK-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,7,9(13),10-pentaene-5,11-diol |
| InChIKey | LVPNMZHEDIKUFK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C3C(=CC(=C2)O)OC(=CC3(O1)O)C |
Computed by PubChem (NCBI)