CAS 24507-29-7 appears in our catalog under these names: 3–Bromo–4–ethoxybenzoic acid, 3-Bromo-4-ethoxybenzoic acid, 3-Bromo-4-ethoxybenzoic acid 95%, 3-bromo-4-ethoxybenzoic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 2g, 10g, 25g, 50g, 100mg, 250mg.
3-bromo-4-ethoxybenzoic acid (CAS 24507-29-7) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 3-bromo-4-ethoxybenzoic acid. InChIKey: XCKMWULLKHQZIP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 3-bromo-4-ethoxybenzoic acid |
| InChIKey | XCKMWULLKHQZIP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)