CAS 245115-20-2 is the registry number for Ethyl (1R,2R)–2–(tert–butoxycarbonylamino)cyclopentanecarboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Trans-ethyl (1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate (CAS 245115-20-2) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate. InChIKey: MHYUFBHMDDIXTD-NXEZZACHSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate |
| InChIKey | MHYUFBHMDDIXTD-NXEZZACHSA-N |
| SMILES | CCOC(=O)[C@@H]1CCC[C@H]1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)