CAS 246224-08-8 is the registry number for 4-Formyl-2-methoxyphenyl pivalate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-formyl-2-methoxyphenyl) 2,2-dimethylpropanoate (CAS 246224-08-8) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 2,2-dimethylpropanoate. InChIKey: WCDZSXPPLCEHMY-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 2,2-dimethylpropanoate |
| InChIKey | WCDZSXPPLCEHMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=C(C=C(C=C1)C=O)OC |
Computed by PubChem (NCBI)