Products 24654-08-8
CAS 24654-08-8 appears in our catalog under these names: 3-(2-Chlorophenyl)prop-2-ynoic acid, 98%, 3-(2-Chlorophenyl)prop-2-ynoic acid, 97%, 97%, 3-(2-chlorophenyl)prop-2-ynoic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 50mg, 500mg, 2.5g, 10g.
3-(2-chlorophenyl)prop-2-ynoic acid (CAS 24654-08-8) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 3-(2-chlorophenyl)prop-2-ynoic acid. InChIKey: GDEUUQMXXWFQTB-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-(2-chlorophenyl)prop-2-ynoic acid |
| InChIKey | GDEUUQMXXWFQTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#CC(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
o-Chlorophenylpropiolic acid, 2-Chlorophenylpropiolic acid, 2-Propynoic acid, 3-(2-chlorophenyl)-, Propiolic acid, (o-chlorophenyl)-, Propynoic acid, (2-chlorophenyl)-, oChlorophenylpropiolic acid, 2Chlorophenylpropiolic acid, Propiolic acid, (ochlorophenyl), Propynoic acid, (2chlorophenyl), 2Propynoic acid, 3(2chlorophenyl)