Products 2468795-96-0
CAS 2468795-96-0 is the registry number for 1,3-Diphenylguanidine-d10, 99.98%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
1,2-bis(2,3,4,5,6-pentadeuteriophenyl)guanidine (CAS 2468795-96-0) is a chemical compound with the molecular formula C13H13N3 and a molecular weight of 221.32 g/mol. IUPAC name: 1,2-bis(2,3,4,5,6-pentadeuteriophenyl)guanidine. InChIKey: OWRCNXZUPFZXOS-LHNTUAQVSA-N.
| Molecular formula | C13H13N3 |
|---|---|
| Molecular weight | 221.32 g/mol |
| IUPAC name | 1,2-bis(2,3,4,5,6-pentadeuteriophenyl)guanidine |
| InChIKey | OWRCNXZUPFZXOS-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=NC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])N)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
N,N'-Diphenylguanidine-d10, orb3134958