Products 2469244-63-9
CAS 2469244-63-9 appears in our catalog under these names: Phosphoric Acid Tris(4-methylphenyl)-d21 Ester, >95% (HPLC), Tri-p-tolyl phosphate-d21. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 2.5 mg.
Tris[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl] phosphate (CAS 2469244-63-9) is a chemical compound with the molecular formula C21H21O4P and a molecular weight of 389.5 g/mol. IUPAC name: tris[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl] phosphate. InChIKey: BOSMZFBHAYFUBJ-QKOAGBKVSA-N.
| Molecular formula | C21H21O4P |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | tris[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl] phosphate |
| InChIKey | BOSMZFBHAYFUBJ-QKOAGBKVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])OP(=O)(OC2=C(C(=C(C(=C2[2H])[2H])C([2H])([2H])[2H])[2H])[2H])OC3=C(C(=C(C(=C3[2H])[2H])C([2H])([2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)