Products 78-30-8
CAS 78-30-8 appears in our catalog under these names: Phosphoric Acid Tris(2-methylphenyl) Ester, >95% (HPLC), Tri-2-cresyl phosphate, Tri-o-cresyl Phosphate, >97.0%(GC), Tri-o-tolyl phosphate, 96%, Tri-o-tolyl phosphate 97%. Offered by: TRC, Dr. Ehrenstorfer, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 100g, 25g, 5g, 250mg, 500g, 10g, 10mM/1mL, 25 g.
Tris(2-methylphenyl) phosphate (CAS 78-30-8) is a chemical compound with the molecular formula C21H21O4P and a molecular weight of 368.4 g/mol. IUPAC name: tris(2-methylphenyl) phosphate. InChIKey: YSMRWXYRXBRSND-UHFFFAOYSA-N.
| Molecular formula | C21H21O4P |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | tris(2-methylphenyl) phosphate |
| InChIKey | YSMRWXYRXBRSND-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OP(=O)(OC2=CC=CC=C2C)OC3=CC=CC=C3C |
Computed by PubChem (NCBI)